* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(AZETIDIN-3-YL)QUINOXALINE |
| CAS: | 1260899-21-5 |
| English Synonyms: | 6-(AZETIDIN-3-YL)QUINOXALINE |
| MDL Number.: | MFCD17480876 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | c1cc2c(cc1C3CNC3)nccn2 |
| InChi: | InChI=1S/C11H11N3/c1-2-10-11(14-4-3-13-10)5-8(1)9-6-12-7-9/h1-5,9,12H,6-7H2 |
| InChiKey: | InChIKey=ZCPQXWSZUBROLV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.