* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(AZETIDIN-3-YL)-2,3-DIMETHYLPHENOL |
| English Synonyms: | 6-(AZETIDIN-3-YL)-2,3-DIMETHYLPHENOL |
| MDL Number.: | MFCD17481093 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(c(c1C)O)C2CNC2 |
| InChi: | InChI=1S/C11H15NO/c1-7-3-4-10(9-5-12-6-9)11(13)8(7)2/h3-4,9,12-13H,5-6H2,1-2H3 |
| InChiKey: | InChIKey=PGQZOHVXWNJEIV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.