* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(AZETIDIN-3-YL)-2,4-DIMETHOXY-3-METHYLPHENOL |
| English Synonyms: | 6-(AZETIDIN-3-YL)-2,4-DIMETHOXY-3-METHYLPHENOL |
| MDL Number.: | MFCD17481220 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1c(cc(c(c1OC)O)C2CNC2)OC |
| InChi: | InChI=1S/C12H17NO3/c1-7-10(15-2)4-9(8-5-13-6-8)11(14)12(7)16-3/h4,8,13-14H,5-6H2,1-3H3 |
| InChiKey: | InChIKey=RNWOCMDLRSXZFW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.