* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(AZETIDIN-3-YL)-3-METHYL-2,4-DINITROPHENOL |
| English Synonyms: | 6-(AZETIDIN-3-YL)-3-METHYL-2,4-DINITROPHENOL |
| MDL Number.: | MFCD17481333 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | Cc1c(cc(c(c1[N+](=O)[O-])O)C2CNC2)[N+](=O)[O-] |
| InChi: | InChI=1S/C10H11N3O5/c1-5-8(12(15)16)2-7(6-3-11-4-6)10(14)9(5)13(17)18/h2,6,11,14H,3-4H2,1H3 |
| InChiKey: | InChIKey=KVRPUCYISRDOQT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.