* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(AZETIDIN-3-YL)-2,3-DIMETHOXYPHENOL |
English Synonyms: | 6-(AZETIDIN-3-YL)-2,3-DIMETHOXYPHENOL |
MDL Number.: | MFCD17481398 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | COc1ccc(c(c1OC)O)C2CNC2 |
InChi: | InChI=1S/C11H15NO3/c1-14-9-4-3-8(7-5-12-6-7)10(13)11(9)15-2/h3-4,7,12-13H,5-6H2,1-2H3 |
InChiKey: | InChIKey=FYWVZMOQUOYQCH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.