* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(AZETIDIN-3-YL)-3,4-DIMETHYL-2-NITROPHENOL |
| English Synonyms: | 6-(AZETIDIN-3-YL)-3,4-DIMETHYL-2-NITROPHENOL |
| MDL Number.: | MFCD17481523 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cc1cc(c(c(c1C)[N+](=O)[O-])O)C2CNC2 |
| InChi: | InChI=1S/C11H14N2O3/c1-6-3-9(8-4-12-5-8)11(14)10(7(6)2)13(15)16/h3,8,12,14H,4-5H2,1-2H3 |
| InChiKey: | InChIKey=QMVKKKOXCXEILR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.