* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-AMINO-2-(AZETIDIN-3-YL)-3-FLUOROPHENOL |
English Synonyms: | 6-AMINO-2-(AZETIDIN-3-YL)-3-FLUOROPHENOL |
MDL Number.: | MFCD17481977 |
H bond acceptor: | 3 |
H bond donor: | 3 |
Smile: | c1cc(c(c(c1N)O)C2CNC2)F |
InChi: | InChI=1S/C9H11FN2O/c10-6-1-2-7(11)9(13)8(6)5-3-12-4-5/h1-2,5,12-13H,3-4,11H2 |
InChiKey: | InChIKey=HLIDGCZCMLDDJN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.