* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(AZETIDIN-3-YL)PYRIDIN-3-AMINE |
| CAS: | 1260811-30-0 |
| English Synonyms: | 6-(AZETIDIN-3-YL)PYRIDIN-3-AMINE ; 3-PYRIDINAMINE, 6-(3-AZETIDINYL)- |
| MDL Number.: | MFCD17482042 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc(ncc1N)C2CNC2 |
| InChi: | InChI=1S/C8H11N3/c9-7-1-2-8(11-5-7)6-3-10-4-6/h1-2,5-6,10H,3-4,9H2 |
| InChiKey: | InChIKey=LWGZKKABUZUPSF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.