* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(AZETIDIN-3-YL)-2,3,4-TRIFLUOROPHENOL |
English Synonyms: | 6-(AZETIDIN-3-YL)-2,3,4-TRIFLUOROPHENOL |
MDL Number.: | MFCD17482146 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1c(c(c(c(c1F)F)F)O)C2CNC2 |
InChi: | InChI=1S/C9H8F3NO/c10-6-1-5(4-2-13-3-4)9(14)8(12)7(6)11/h1,4,13-14H,2-3H2 |
InChiKey: | InChIKey=RBBBAAIYPXSITI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.