* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-(AZETIDIN-3-YL)-1,2,3,4-TETRAHYDROACRIDINE |
English Synonyms: | 9-(AZETIDIN-3-YL)-1,2,3,4-TETRAHYDROACRIDINE |
MDL Number.: | MFCD17482267 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c(c3c(n2)CCCC3)C4CNC4 |
InChi: | InChI=1S/C16H18N2/c1-3-7-14-12(5-1)16(11-9-17-10-11)13-6-2-4-8-15(13)18-14/h1,3,5,7,11,17H,2,4,6,8-10H2 |
InChiKey: | InChIKey=UMKGFIHAOAAGQH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.