* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-(AZETIDIN-3-YL)-1H-PYRROLO[3,2-B]PYRIDINE |
| English Synonyms: | 3-(1H-PYRROLO[3,2-B]PYRIDIN-6-YL)AZETIDINE ; 6-(AZETIDIN-3-YL)-1H-PYRROLO[3,2-B]PYRIDINE |
| MDL Number.: | MFCD17482375 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1c[nH]c2c1ncc(c2)C3CNC3 |
| InChi: | InChI=1S/C10H11N3/c1-2-12-10-3-7(6-13-9(1)10)8-4-11-5-8/h1-3,6,8,11-12H,4-5H2 |
| InChiKey: | InChIKey=XXHMDBGTLUARLD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.