* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(PYRROLIDIN-3-YL)PYRIDIN-3-AMINE |
English Synonyms: | 6-(PYRROLIDIN-3-YL)PYRIDIN-3-AMINE |
MDL Number.: | MFCD17484119 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc(ncc1N)C2CCNC2 |
InChi: | InChI=1S/C9H13N3/c10-8-1-2-9(12-6-8)7-3-4-11-5-7/h1-2,6-7,11H,3-5,10H2 |
InChiKey: | InChIKey=FLWWEFGTAZWTON-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.