* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-CHLORO-5-(PYRROLIDIN-3-YL)PYRIDIN-2-OL |
| English Synonyms: | 6-CHLORO-5-(PYRROLIDIN-3-YL)PYRIDIN-2-OL |
| MDL Number.: | MFCD17484445 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc(nc(c1C2CCNC2)Cl)O |
| InChi: | InChI=1S/C9H11ClN2O/c10-9-7(1-2-8(13)12-9)6-3-4-11-5-6/h1-2,6,11H,3-5H2,(H,12,13) |
| InChiKey: | InChIKey=XWVLHQOSSAIXCF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.