* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(PYRROLIDIN-3-YL)-1H-PYRROLO[3,2-B]PYRIDINE |
English Synonyms: | 6-(PYRROLIDIN-3-YL)-1H-PYRROLO[3,2-B]PYRIDINE |
MDL Number.: | MFCD17484450 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1c[nH]c2c1ncc(c2)C3CCNC3 |
InChi: | InChI=1S/C11H13N3/c1-3-12-6-8(1)9-5-11-10(14-7-9)2-4-13-11/h2,4-5,7-8,12-13H,1,3,6H2 |
InChiKey: | InChIKey=NZBFJAFUWSJJJC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.