* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-CHLORO-7-(PIPERIDIN-4-YL)-[1,3]DIOXOLO[4,5-G]QUINOLINE |
| English Synonyms: | 6-CHLORO-7-(PIPERIDIN-4-YL)-[1,3]DIOXOLO[4,5-G]QUINOLINE |
| MDL Number.: | MFCD17486264 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1c2cc3c(cc2nc(c1C4CCNCC4)Cl)OCO3 |
| InChi: | InChI=1S/C15H15ClN2O2/c16-15-11(9-1-3-17-4-2-9)5-10-6-13-14(20-8-19-13)7-12(10)18-15/h5-7,9,17H,1-4,8H2 |
| InChiKey: | InChIKey=TYYPLJMDIKQTKA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.