* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-CHLORO-3-(PIPERIDIN-4-YL)QUINOLIN-4-OL |
English Synonyms: | 6-CHLORO-3-(PIPERIDIN-4-YL)QUINOLIN-4-OL |
MDL Number.: | MFCD17486328 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc2c(cc1Cl)c(c(cn2)C3CCNCC3)O |
InChi: | InChI=1S/C14H15ClN2O/c15-10-1-2-13-11(7-10)14(18)12(8-17-13)9-3-5-16-6-4-9/h1-2,7-9,16H,3-6H2,(H,17,18) |
InChiKey: | InChIKey=MXWYTNQAZVQKBL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.