* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-METHYL-4-(PIPERIDIN-4-YL)PYRIDIN-2-OL |
| English Synonyms: | 6-METHYL-4-(PIPERIDIN-4-YL)PYRIDIN-2-OL |
| MDL Number.: | MFCD17486434 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | Cc1cc(cc(n1)O)C2CCNCC2 |
| InChi: | InChI=1S/C11H16N2O/c1-8-6-10(7-11(14)13-8)9-2-4-12-5-3-9/h6-7,9,12H,2-5H2,1H3,(H,13,14) |
| InChiKey: | InChIKey=XUPLBUDAOXGNCB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.