* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 4253241 |
| English Synonyms: | OTAVA-BB 4253241 |
| MDL Number.: | MFCD17486479 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | CCSc1ccc(cc1)C2CCNCC2 |
| InChi: | InChI=1S/C13H19NS/c1-2-15-13-5-3-11(4-6-13)12-7-9-14-10-8-12/h3-6,12,14H,2,7-10H2,1H3 |
| InChiKey: | InChIKey=OUTAPRAXSIVEJB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.