Molecular Structure:
CCD No.:CCD03739436
OTAVA-BB 3989024
Formula:C13 H15 N S
MolWeight:217.335
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 3989024 |
| English Synonyms： | OTAVA-BB 3989024 |
| MDL Number.： | MFCD17487356 |
| H bond acceptor： | 1 |
| H bond donor： | 1 |
| Smile： | c1ccc2c(c1)c(cs2)C3CCCNC3 |
| InChi： | InChI=1S/C13H15NS/c1-2-6-13-11(5-1)12(9-15-13)10-4-3-7-14-8-10/h1-2,5-6,9-10,14H,3-4,7-8H2 |
| InChiKey： | InChIKey=RRSJSUMOAGOCKA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
