Molecular Structure:
CCD No.:CCD03739465
OTAVA-BB 3989025
Formula:C13 H15 N S
MolWeight:217.335
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 3989025 |
| English Synonyms： | OTAVA-BB 3989025 |
| MDL Number.： | MFCD17487396 |
| H bond acceptor： | 1 |
| H bond donor： | 1 |
| Smile： | c1ccc2c(c1)cc(s2)C3CCCNC3 |
| InChi： | InChI=1S/C13H15NS/c1-2-6-12-10(4-1)8-13(15-12)11-5-3-7-14-9-11/h1-2,4,6,8,11,14H,3,5,7,9H2 |
| InChiKey： | InChIKey=RQYNGDPJESHEHN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
