* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(PIPERIDIN-3-YL)PYRIDIN-2-AMINE |
English Synonyms: | 6-(PIPERIDIN-3-YL)PYRIDIN-2-AMINE |
MDL Number.: | MFCD17488290 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1cc(nc(c1)N)C2CCCNC2 |
InChi: | InChI=1S/C10H15N3/c11-10-5-1-4-9(13-10)8-3-2-6-12-7-8/h1,4-5,8,12H,2-3,6-7H2,(H2,11,13) |
InChiKey: | InChIKey=QEPULKVNZDZKLG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.