* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-METHYL-4-(PIPERIDIN-3-YL)QUINOLIN-2-OL |
English Synonyms: | 8-METHYL-4-(PIPERIDIN-3-YL)QUINOLIN-2-OL |
MDL Number.: | MFCD17488462 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1cccc2c1nc(cc2C3CCCNC3)O |
InChi: | InChI=1S/C15H18N2O/c1-10-4-2-6-12-13(8-14(18)17-15(10)12)11-5-3-7-16-9-11/h2,4,6,8,11,16H,3,5,7,9H2,1H3,(H,17,18) |
InChiKey: | InChIKey=OKQPQADTBUQQPX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.