* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-CHLORO-7-(PIPERIDIN-3-YL)-[1,3]DIOXOLO[4,5-G]QUINOLINE |
English Synonyms: | 6-CHLORO-7-(PIPERIDIN-3-YL)-[1,3]DIOXOLO[4,5-G]QUINOLINE |
MDL Number.: | MFCD17488472 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1c2cc3c(cc2nc(c1C4CCCNC4)Cl)OCO3 |
InChi: | InChI=1S/C15H15ClN2O2/c16-15-11(9-2-1-3-17-7-9)4-10-5-13-14(20-8-19-13)6-12(10)18-15/h4-6,9,17H,1-3,7-8H2 |
InChiKey: | InChIKey=PFTKHQYNTXWHBQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.