* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-METHYL-3-(PIPERIDIN-3-YL)PYRIDINE-2,4-DIOL |
| English Synonyms: | 6-METHYL-3-(PIPERIDIN-3-YL)PYRIDINE-2,4-DIOL |
| MDL Number.: | MFCD17488596 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | Cc1cc(c(c(n1)O)C2CCCNC2)O |
| InChi: | InChI=1S/C11H16N2O2/c1-7-5-9(14)10(11(15)13-7)8-3-2-4-12-6-8/h5,8,12H,2-4,6H2,1H3,(H2,13,14,15) |
| InChiKey: | InChIKey=YACKMIMQNISAHF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.