* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-METHYL-3-(PIPERIDIN-3-YL)PYRIDIN-2-OL |
English Synonyms: | 6-METHYL-3-(PIPERIDIN-3-YL)PYRIDIN-2-OL |
MDL Number.: | MFCD17488608 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | Cc1ccc(c(n1)O)C2CCCNC2 |
InChi: | InChI=1S/C11H16N2O/c1-8-4-5-10(11(14)13-8)9-3-2-6-12-7-9/h4-5,9,12H,2-3,6-7H2,1H3,(H,13,14) |
InChiKey: | InChIKey=WCEGEECBJPUZMI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.