* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-NITRO-3-(PIPERIDIN-3-YL)QUINOLIN-2-OL |
English Synonyms: | 6-NITRO-3-(PIPERIDIN-3-YL)QUINOLIN-2-OL |
MDL Number.: | MFCD17488644 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1cc2c(cc1[N+](=O)[O-])cc(c(n2)O)C3CCCNC3 |
InChi: | InChI=1S/C14H15N3O3/c18-14-12(9-2-1-5-15-8-9)7-10-6-11(17(19)20)3-4-13(10)16-14/h3-4,6-7,9,15H,1-2,5,8H2,(H,16,18) |
InChiKey: | InChIKey=MIFIEAPYWHINNT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.