Molecular Structure:
CCD No.:CCD03740716
OTAVA-BB 4253250
Formula:C13 H19 N S
MolWeight:221.366
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 4253250 |
| English Synonyms： | OTAVA-BB 4253250 |
| MDL Number.： | MFCD17488688 |
| H bond acceptor： | 1 |
| H bond donor： | 1 |
| Smile： | CCSc1ccc(cc1)C2CCCNC2 |
| InChi： | InChI=1S/C13H19NS/c1-2-15-13-7-5-11(6-8-13)12-4-3-9-14-10-12/h5-8,12,14H,2-4,9-10H2,1H3 |
| InChiKey： | InChIKey=RJGWALOAONDNIH-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
