* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-METHYL-N-(1-METHYL-1H-PYRAZOL-4-YL)-3-THIA-1-AZASPIRO[4.5]DEC-1-EN-2-AMINE |
| English Synonyms: | 7-METHYL-N-(1-METHYL-1H-PYRAZOL-4-YL)-3-THIA-1-AZASPIRO[4.5]DEC-1-EN-2-AMINE |
| MDL Number.: | MFCD17500191 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC1CCCC2(C1)CSC(=N2)Nc3cnn(c3)C |
| InChi: | InChI=1S/C13H20N4S/c1-10-4-3-5-13(6-10)9-18-12(16-13)15-11-7-14-17(2)8-11/h7-8,10H,3-6,9H2,1-2H3,(H,15,16) |
| InChiKey: | InChIKey=OAKGKYXGQRBCLD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.