* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6,7-DIFLUORO-1-[2-(1H-IMIDAZOL-1-YL)ETHYL]-1H-1,3-BENZODIAZOLE-2-THIOL |
English Synonyms: | 6,7-DIFLUORO-1-[2-(1H-IMIDAZOL-1-YL)ETHYL]-1H-1,3-BENZODIAZOLE-2-THIOL |
MDL Number.: | MFCD17501385 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1cc(c(c2c1nc(n2CCn3ccnc3)S)F)F |
InChi: | InChI=1S/C12H10F2N4S/c13-8-1-2-9-11(10(8)14)18(12(19)16-9)6-5-17-4-3-15-7-17/h1-4,7H,5-6H2,(H,16,19) |
InChiKey: | InChIKey=WMCMPPJFQPXPHG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.