Molecular Structure:
CCD No.:CCD03754597
OTAVA-BB 2044623
Formula:C13 H13 Cl N2 S
MolWeight:264.779
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 2044623 |
| English Synonyms： | OTAVA-BB 2044623 |
| MDL Number.： | MFCD17503145 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1ccc(c(c1)Cc2nc3c(s2)CNCC3)Cl |
| InChi： | InChI=1S/C13H13ClN2S/c14-10-4-2-1-3-9(10)7-13-16-11-5-6-15-8-12(11)17-13/h1-4,15H,5-8H2 |
| InChiKey： | InChIKey=LPXVQQIHFNELDP-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
