* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-(OXOLAN-2-YLMETHYL)-6,7,8,9-TETRAHYDRO-5H-BENZO[7]ANNULEN-5-OL |
English Synonyms: | 6-(OXOLAN-2-YLMETHYL)-6,7,8,9-TETRAHYDRO-5H-BENZO[7]ANNULEN-5-OL |
MDL Number.: | MFCD17509434 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)CCCC(C2O)CC3CCCO3 |
InChi: | InChI=1S/C16H22O2/c17-16-13(11-14-8-4-10-18-14)7-3-6-12-5-1-2-9-15(12)16/h1-2,5,9,13-14,16-17H,3-4,6-8,10-11H2 |
InChiKey: | InChIKey=URSPPZRJJDCAMM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.