* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | PROPYL 2-AMINO-5-(4-METHYL-1,3-THIAZOL-2-YL)BENZOATE |
| English Synonyms: | PROPYL 2-AMINO-5-(4-METHYL-1,3-THIAZOL-2-YL)BENZOATE |
| MDL Number.: | MFCD17515743 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCCOC(=O)c1cc(ccc1N)c2nc(cs2)C |
| InChi: | InChI=1S/C14H16N2O2S/c1-3-6-18-14(17)11-7-10(4-5-12(11)15)13-16-9(2)8-19-13/h4-5,7-8H,3,6,15H2,1-2H3 |
| InChiKey: | InChIKey=LMTGRRPHYRUQMN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.