* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-BROMO-N-ETHYL-2H,3H,7H,8H,9H,10H-NAPHTHO[1,2-B][1,4]DIOXIN-10-AMINE |
| English Synonyms: | 6-BROMO-N-ETHYL-2H,3H,7H,8H,9H,10H-NAPHTHO[1,2-B][1,4]DIOXIN-10-AMINE |
| MDL Number.: | MFCD17528212 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CCNC1CCCc2c1c3c(cc2Br)OCCO3 |
| InChi: | InChI=1S/C14H18BrNO2/c1-2-16-11-5-3-4-9-10(15)8-12-14(13(9)11)18-7-6-17-12/h8,11,16H,2-7H2,1H3 |
| InChiKey: | InChIKey=CKMUEYKCAWMILG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.