Molecular Structure:
CCD No.:CCD03782622
OTAVA-BB 2120185
Formula:C12 H16 O4 S
MolWeight:256.32
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 2120185 |
| English Synonyms： | OTAVA-BB 2120185 |
| MDL Number.： | MFCD17532203 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCC(C(=O)O)S(=O)(=O)Cc1ccccc1C |
| InChi： | InChI=1S/C12H16O4S/c1-3-11(12(13)14)17(15,16)8-10-7-5-4-6-9(10)2/h4-7,11H,3,8H2,1-2H3,(H,13,14) |
| InChiKey： | InChIKey=QDNUMHBTQAKMBY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
