* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZXW006128 |
| English Synonyms: | ZERENEX ZXW006128 |
| MDL Number.: | MFCD17573848 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C(=O)N1CCCCC1)NS(=O)(=O)c2ccccc2F |
| InChi: | InChI=1S/C14H19FN2O3S/c1-11(14(18)17-9-5-2-6-10-17)16-21(19,20)13-8-4-3-7-12(13)15/h3-4,7-8,11,16H,2,5-6,9-10H2,1H3 |
| InChiKey: | InChIKey=JAAYXISAVGKXSK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.