Molecular Structure:
CCD No.:CCD03788993
OTAVA-BB 1907199
Formula:C12 H15 N O2
MolWeight:205.255
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1907199 |
| English Synonyms： | OTAVA-BB 1907199 |
| MDL Number.： | MFCD17578547 |
| H bond acceptor： | 3 |
| H bond donor： | 1 |
| Smile： | Cc1ccc(cc1)C(=O)CCC(=O)NC |
| InChi： | InChI=1S/C12H15NO2/c1-9-3-5-10(6-4-9)11(14)7-8-12(15)13-2/h3-6H,7-8H2,1-2H3,(H,13,15) |
| InChiKey： | InChIKey=AYENFIPRNDUDMN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
