* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-(2,3,5-TRIFLUOROPHENYL)-9-AZABICYCLO[3.3.1]NONAN-3-AMINE |
| English Synonyms: | 9-(2,3,5-TRIFLUOROPHENYL)-9-AZABICYCLO[3.3.1]NONAN-3-AMINE |
| MDL Number.: | MFCD17589083 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1c(cc(c(c1N2C3CCCC2CC(C3)N)F)F)F |
| InChi: | InChI=1S/C14H17F3N2/c15-8-4-12(16)14(17)13(5-8)19-10-2-1-3-11(19)7-9(18)6-10/h4-5,9-11H,1-3,6-7,18H2 |
| InChiKey: | InChIKey=SITQMYZRQLEETJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.