* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-N-[1-(THIOPHEN-3-YL)ETHYL]-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
| English Synonyms: | 8-METHYL-N-[1-(THIOPHEN-3-YL)ETHYL]-8-AZABICYCLO[3.2.1]OCTAN-3-AMINE |
| MDL Number.: | MFCD17592512 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC(c1ccsc1)NC2CC3CCC(C2)N3C |
| InChi: | InChI=1S/C14H22N2S/c1-10(11-5-6-17-9-11)15-12-7-13-3-4-14(8-12)16(13)2/h5-6,9-10,12-15H,3-4,7-8H2,1-2H3 |
| InChiKey: | InChIKey=KSUSNIUQENXKOB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.