* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-BROMO-5-CHLORO-1,2,3,4,9,10-HEXAHYDROACRIDIN-9-ONE |
English Synonyms: | 8-BROMO-5-CHLORO-1,2,3,4,9,10-HEXAHYDROACRIDIN-9-ONE |
MDL Number.: | MFCD17601364 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1cc(c2c(c1Cl)[nH]c3c(c2=O)CCCC3)Br |
InChi: | InChI=1S/C13H11BrClNO/c14-8-5-6-9(15)12-11(8)13(17)7-3-1-2-4-10(7)16-12/h5-6H,1-4H2,(H,16,17) |
InChiKey: | InChIKey=ZGYIOOZBGCVKCZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.