* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8,10-DIMETHYL-1,2,3,4-TETRAHYDRO-[1,4]DIAZEPINO[6,5-C]QUINOLIN-5-ONE |
English Synonyms: | 8,10-DIMETHYL-1,2,3,4-TETRAHYDRO-[1,4]DIAZEPINO[6,5-C]QUINOLIN-5-ONE |
MDL Number.: | MFCD17779481 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cc1cc(c2c(c1)c3c(cn2)C(=O)NCCN3)C |
InChi: | InChI=1S/C14H15N3O/c1-8-5-9(2)12-10(6-8)13-11(7-17-12)14(18)16-4-3-15-13/h5-7,15H,3-4H2,1-2H3,(H,16,18) |
InChiKey: | InChIKey=LYLPIMWWZIWJTN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.