* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(3,5-DIMETHYLPHENOXY)[1,2,4]TRIAZOLO[4,3-A]PYRAZIN-3(2H)-ONE |
English Synonyms: | 8-(3,5-DIMETHYL-PHENOXY)-2H-[1,2,4]TRIAZOLO[4,3-A]PYRAZIN-3-ONE ; 8-(3,5-DIMETHYLPHENOXY)[1,2,4]TRIAZOLO[4,3-A]PYRAZIN-3(2H)-ONE |
MDL Number.: | MFCD17780353 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1cc(cc(c1)Oc2c3n[nH]c(=O)n3ccn2)C |
InChi: | InChI=1S/C13H12N4O2/c1-8-5-9(2)7-10(6-8)19-12-11-15-16-13(18)17(11)4-3-14-12/h3-7H,1-2H3,(H,16,18) |
InChiKey: | InChIKey=SWFJNPLSYFYXHS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.