* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(4-METHYLPIPERIDIN-1-YL)[1,2,4]TRIAZOLO[4,3-A]PYRAZIN-3(2H)-ONE |
English Synonyms: | 8-(4-METHYLPIPERIDIN-1-YL)[1,2,4]TRIAZOLO[4,3-A]PYRAZIN-3(2H)-ONE ; 8-(4-METHYL-PIPERIDIN-1-YL)-2H-[1,2,4]TRIAZOLO[4,3-A]PYRAZIN-3-ONE |
MDL Number.: | MFCD17780366 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC1CCN(CC1)c2c3n[nH]c(=O)n3ccn2 |
InChi: | InChI=1S/C11H15N5O/c1-8-2-5-15(6-3-8)9-10-13-14-11(17)16(10)7-4-12-9/h4,7-8H,2-3,5-6H2,1H3,(H,14,17) |
InChiKey: | InChIKey=DFJVJSNKVZYPQO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.