* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-(MORPHOLIN-4-YL)[1,2,4]TRIAZOLO[4,3-A]PYRAZIN-3(2H)-ONE |
English Synonyms: | 8-(MORPHOLIN-4-YL)[1,2,4]TRIAZOLO[4,3-A]PYRAZIN-3(2H)-ONE ; 8-MORPHOLIN-4-YL-2H-[1,2,4]TRIAZOLO[4,3-A]PYRAZIN-3-ONE |
MDL Number.: | MFCD17780369 |
H bond acceptor: | 7 |
H bond donor: | 1 |
Smile: | c1cn2c(c(n1)N3CCOCC3)n[nH]c2=O |
InChi: | InChI=1S/C9H11N5O2/c15-9-12-11-8-7(10-1-2-14(8)9)13-3-5-16-6-4-13/h1-2H,3-6H2,(H,12,15) |
InChiKey: | InChIKey=ZDAPXFHNWWFXBW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.