* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-[4-(2-METHYLPHENYL)PIPERAZIN-1-YL][1,2,4]TRIAZOLO[4,3-A]PYRAZIN-3(2H)-ONE |
| English Synonyms: | 8-[4-(2-METHYLPHENYL)PIPERAZIN-1-YL][1,2,4]TRIAZOLO[4,3-A]PYRAZIN-3(2H)-ONE ; 8-(4-O-TOLYL-PIPERAZIN-1-YL)-2H-[1,2,4]TRIAZOLO[4,3-A]PYRAZIN-3-ONE |
| MDL Number.: | MFCD17780371 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | Cc1ccccc1N2CCN(CC2)c3c4n[nH]c(=O)n4ccn3 |
| InChi: | InChI=1S/C16H18N6O/c1-12-4-2-3-5-13(12)20-8-10-21(11-9-20)14-15-18-19-16(23)22(15)7-6-17-14/h2-7H,8-11H2,1H3,(H,19,23) |
| InChiKey: | InChIKey=ZDCJLVXLPMCOMA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.