* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 8-[2-(4-METHYL-1,3-THIAZOL-5-YL)ETHOXY]-1,2,3,4-TETRAHYDROQUINOLINE |
English Synonyms: | 8-[2-(4-METHYL-1,3-THIAZOL-5-YL)ETHOXY]-1,2,3,4-TETRAHYDROQUINOLINE |
MDL Number.: | MFCD17929304 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | Cc1c(scn1)CCOc2cccc3c2NCCC3 |
InChi: | InChI=1S/C15H18N2OS/c1-11-14(19-10-17-11)7-9-18-13-6-2-4-12-5-3-8-16-15(12)13/h2,4,6,10,16H,3,5,7-9H2,1H3 |
InChiKey: | InChIKey=WFVCVKXUYXAJDN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.