* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5817506 |
English Synonyms: | ABAMACHEM ABA-5817506 |
MDL Number.: | MFCD17959749 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCNC(CCc1ccc(s1)CC)COC |
InChi: | InChI=1S/C14H25NOS/c1-4-10-15-12(11-16-3)6-7-14-9-8-13(5-2)17-14/h8-9,12,15H,4-7,10-11H2,1-3H3 |
InChiKey: | InChIKey=GPDKKUXMCXHTJP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.