* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABAMACHEM ABA-5823507 |
English Synonyms: | ABAMACHEM ABA-5823507 |
MDL Number.: | MFCD17965094 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CCCNC(c1ccccc1Cl)c2ccc(o2)CC |
InChi: | InChI=1S/C16H20ClNO/c1-3-11-18-16(13-7-5-6-8-14(13)17)15-10-9-12(4-2)19-15/h5-10,16,18H,3-4,11H2,1-2H3 |
InChiKey: | InChIKey=URUIKGNKVRDGOT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.