* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5823806 |
| English Synonyms: | ABAMACHEM ABA-5823806 |
| MDL Number.: | MFCD17965378 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | Cc1cccc(c1)/C=C/C(=O)NC2CCCCC2O |
| InChi: | InChI=1S/C16H21NO2/c1-12-5-4-6-13(11-12)9-10-16(19)17-14-7-2-3-8-15(14)18/h4-6,9-11,14-15,18H,2-3,7-8H2,1H3,(H,17,19)/b10-9+ |
| InChiKey: | InChIKey=WQOXLDPCWGPMCJ-MDZDMXLPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.