* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5825097 |
| English Synonyms: | ABAMACHEM ABA-5825097 |
| MDL Number.: | MFCD17966641 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1cscc1C(c2cc3c(cc2Br)[nH]c(=O)[nH]3)N |
| InChi: | InChI=1S/C12H10BrN3OS/c13-8-4-10-9(15-12(17)16-10)3-7(8)11(14)6-1-2-18-5-6/h1-5,11H,14H2,(H2,15,16,17) |
| InChiKey: | InChIKey=LGSOFLHWFHCMHS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.