* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ABAMACHEM ABA-5827356 |
| English Synonyms: | ABAMACHEM ABA-5827356 |
| MDL Number.: | MFCD17968862 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | Cc1nc(cs1)CNCCC2CCCCN2C |
| InChi: | InChI=1S/C13H23N3S/c1-11-15-12(10-17-11)9-14-7-6-13-5-3-4-8-16(13)2/h10,13-14H,3-9H2,1-2H3 |
| InChiKey: | InChIKey=MAJDOZBXGYUYFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.